C17H21N5O2 — CID 98779007
[(5aS,9aR)-4-pyrimidin-2-yl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 98779007) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is [(5aS,9aR)-4-pyrimidin-2-yl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(5aS,9aR)-4-pyrimidin-2-yl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 98779007 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | [(5aS,9aR)-4-pyrimidin-2-yl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc[nH]1)N1CC[C@H]2CN(c3ncccn3)CCO[C@H]2C1 |
| InChI | InChI=1S/C17H21N5O2/c23-16(14-3-1-5-18-14)21-8-4-13-11-22(9-10-24-15(13)12-21)17-19-6-2-7-20-17/h1-3,5-7,13,15,18H,4,8-12H2/t13-,15-/m0/s1 |
| InChIKey | WYVUBWCLPCAMLG-ZFWWWQNUSA-N |
| XLogP | 1.17 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |