C15H22N6O2 — CID 133135825
[(5aS,8aS)-4-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-pyrazolidin-3-ylmethanone (PubChem CID 133135825) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is [(5aS,8aS)-4-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-pyrazolidin-3-ylmethanone.
| Compound Name | [(5aS,8aS)-4-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-pyrazolidin-3-ylmethanone |
|---|---|
| PubChem CID | 133135825 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [(5aS,8aS)-4-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-pyrazolidin-3-ylmethanone |
| SMILES | O=C(C1CCNN1)N1C[C@@H]2CN(c3ncccn3)CCO[C@@H]2C1 |
| InChI | InChI=1S/C15H22N6O2/c22-14(12-2-5-18-19-12)21-9-11-8-20(6-7-23-13(11)10-21)15-16-3-1-4-17-15/h1,3-4,11-13,18-19H,2,5-10H2/t11-,12?,13+/m0/s1 |
| InChIKey | VHAYSZDEJCOPRO-IAMFDIQRSA-N |
| XLogP | -0.99 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |