C19H21F3N6O5 — CID 155869362
[(5aS,8aS)-4-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5-methoxypyrimidin-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155869362) has the molecular formula C19H21F3N6O5 and a molecular weight of 470.41 g/mol. Its IUPAC name is [(5aS,8aS)-4-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5-methoxypyrimidin-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(5aS,8aS)-4-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5-methoxypyrimidin-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869362 |
| Molecular Formula | C19H21F3N6O5 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [(5aS,8aS)-4-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5-methoxypyrimidin-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1cnc(C(=O)N2C[C@@H]3CN(c4ncccn4)CCO[C@@H]3C2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N6O3.C2HF3O2/c1-25-13-7-20-15(21-8-13)16(24)23-10-12-9-22(5-6-26-14(12)11-23)17-18-3-2-4-19-17;3-2(4,5)1(6)7/h2-4,7-8,12,14H,5-6,9-11H2,1H3;(H,6,7)/t12-,14+;/m0./s1 |
| InChIKey | CQRFXHPNJRJIMK-DSHXVJGRSA-N |
| XLogP | 0.89 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |