C17H26N2OS — CID 97378976
(3S,3aR,7aR)-3-(pyrrolidin-1-ylmethyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine (PubChem CID 97378976) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is (3S,3aR,7aR)-3-(pyrrolidin-1-ylmethyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine.
| Compound Name | (3S,3aR,7aR)-3-(pyrrolidin-1-ylmethyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
|---|---|
| PubChem CID | 97378976 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (3S,3aR,7aR)-3-(pyrrolidin-1-ylmethyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
| SMILES | c1cc(CN2CC[C@H]3CO[C@H](CN4CCCC4)[C@H]3C2)cs1 |
| InChI | InChI=1S/C17H26N2OS/c1-2-6-18(5-1)11-17-16-10-19(7-3-15(16)12-20-17)9-14-4-8-21-13-14/h4,8,13,15-17H,1-3,5-7,9-12H2/t15-,16-,17+/m0/s1 |
| InChIKey | WCIQUZNDORSWNH-YESZJQIVSA-N |
| XLogP | 2.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |