C11H19N3O2S2 — CID 63605065
5-(3-ethyl-4-methylpiperazin-1-yl)sulfonylthiophen-3-amine (PubChem CID 63605065) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 5-(3-ethyl-4-methylpiperazin-1-yl)sulfonylthiophen-3-amine.
| Compound Name | 5-(3-ethyl-4-methylpiperazin-1-yl)sulfonylthiophen-3-amine |
|---|---|
| PubChem CID | 63605065 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-(3-ethyl-4-methylpiperazin-1-yl)sulfonylthiophen-3-amine |
| SMILES | CCC1CN(S(=O)(=O)c2cc(N)cs2)CCN1C |
| InChI | InChI=1S/C11H19N3O2S2/c1-3-10-7-14(5-4-13(10)2)18(15,16)11-6-9(12)8-17-11/h6,8,10H,3-5,7,12H2,1-2H3 |
| InChIKey | LRPKWEIUCPJDHT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |