C11H19N3O4S3 — CID 61299606
5-(4-propylsulfonylpiperazin-1-yl)sulfonylthiophen-3-amine (PubChem CID 61299606) has the molecular formula C11H19N3O4S3 and a molecular weight of 353.49 g/mol. Its IUPAC name is 5-(4-propylsulfonylpiperazin-1-yl)sulfonylthiophen-3-amine.
| Compound Name | 5-(4-propylsulfonylpiperazin-1-yl)sulfonylthiophen-3-amine |
|---|---|
| PubChem CID | 61299606 |
| Molecular Formula | C11H19N3O4S3 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 5-(4-propylsulfonylpiperazin-1-yl)sulfonylthiophen-3-amine |
| SMILES | CCCS(=O)(=O)N1CCN(S(=O)(=O)c2cc(N)cs2)CC1 |
| InChI | InChI=1S/C11H19N3O4S3/c1-2-7-20(15,16)13-3-5-14(6-4-13)21(17,18)11-8-10(12)9-19-11/h8-9H,2-7,12H2,1H3 |
| InChIKey | UEHXEXQLVCWCKR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |