C11H19N3O4S3 — CID 61299995
N-[1-(4-aminothiophen-2-yl)sulfonylpiperidin-4-yl]ethanesulfonamide (PubChem CID 61299995) has the molecular formula C11H19N3O4S3 and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[1-(4-aminothiophen-2-yl)sulfonylpiperidin-4-yl]ethanesulfonamide.
| Compound Name | N-[1-(4-aminothiophen-2-yl)sulfonylpiperidin-4-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 61299995 |
| Molecular Formula | C11H19N3O4S3 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-[1-(4-aminothiophen-2-yl)sulfonylpiperidin-4-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCN(S(=O)(=O)c2cc(N)cs2)CC1 |
| InChI | InChI=1S/C11H19N3O4S3/c1-2-20(15,16)13-10-3-5-14(6-4-10)21(17,18)11-7-9(12)8-19-11/h7-8,10,13H,2-6,12H2,1H3 |
| InChIKey | RAKWPOKXUQACIA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |