C12H18BrN3O3S2 — CID 79998589
[1-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methylurea (PubChem CID 79998589) has the molecular formula C12H18BrN3O3S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is [1-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methylurea.
| Compound Name | [1-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 79998589 |
| Molecular Formula | C12H18BrN3O3S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | [1-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methylurea |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC(CNC(N)=O)C2)sc1Br |
| InChI | InChI=1S/C12H18BrN3O3S2/c1-8-5-10(20-11(8)13)21(18,19)16-4-2-3-9(7-16)6-15-12(14)17/h5,9H,2-4,6-7H2,1H3,(H3,14,15,17) |
| InChIKey | VBHNBQCUNFFNBR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |