C10H16BrClN2O2S2 — CID 119988663
[1-(5-bromo-4-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 119988663) has the molecular formula C10H16BrClN2O2S2 and a molecular weight of 375.74 g/mol. Its IUPAC name is [1-(5-bromo-4-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(5-bromo-4-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119988663 |
| Molecular Formula | C10H16BrClN2O2S2 |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | [1-(5-bromo-4-methylthiophen-2-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC2CN)sc1Br.Cl |
| InChI | InChI=1S/C10H15BrN2O2S2.ClH/c1-7-5-9(16-10(7)11)17(14,15)13-4-2-3-8(13)6-12;/h5,8H,2-4,6,12H2,1H3;1H |
| InChIKey | ISGQALNPWFPAIH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |