C11H13BrN2O2S2 — CID 79989340
1-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperidine-2-carbonitrile (PubChem CID 79989340) has the molecular formula C11H13BrN2O2S2 and a molecular weight of 349.28 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperidine-2-carbonitrile.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperidine-2-carbonitrile |
|---|---|
| PubChem CID | 79989340 |
| Molecular Formula | C11H13BrN2O2S2 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonylpiperidine-2-carbonitrile |
| SMILES | Cc1cc(S(=O)(=O)N2CCCCC2C#N)sc1Br |
| InChI | InChI=1S/C11H13BrN2O2S2/c1-8-6-10(17-11(8)12)18(15,16)14-5-3-2-4-9(14)7-13/h6,9H,2-5H2,1H3 |
| InChIKey | XVIMSNKIOZGAIO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |