C11H15BrClNO2S2 — CID 79989386
1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-2-(chloromethyl)piperidine (PubChem CID 79989386) has the molecular formula C11H15BrClNO2S2 and a molecular weight of 372.74 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-2-(chloromethyl)piperidine.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-2-(chloromethyl)piperidine |
|---|---|
| PubChem CID | 79989386 |
| Molecular Formula | C11H15BrClNO2S2 |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-2-(chloromethyl)piperidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCCCC2CCl)sc1Br |
| InChI | InChI=1S/C11H15BrClNO2S2/c1-8-6-10(17-11(8)12)18(15,16)14-5-3-2-4-9(14)7-13/h6,9H,2-5,7H2,1H3 |
| InChIKey | BTHIPIASXYJEJL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|