C11H13BrClNO3S2 — CID 80577652
1-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpyrrolidin-2-yl]propan-2-one (PubChem CID 80577652) has the molecular formula C11H13BrClNO3S2 and a molecular weight of 386.72 g/mol. Its IUPAC name is 1-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpyrrolidin-2-yl]propan-2-one.
| Compound Name | 1-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpyrrolidin-2-yl]propan-2-one |
|---|---|
| PubChem CID | 80577652 |
| Molecular Formula | C11H13BrClNO3S2 |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 384.92 |
| IUPAC Name | 1-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpyrrolidin-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCN1S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C11H13BrClNO3S2/c1-7(15)5-8-3-2-4-14(8)19(16,17)10-6-9(13)11(12)18-10/h6,8H,2-5H2,1H3 |
| InChIKey | SLVSCOCMFILNSX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |