C10H10BrClN2O5S2 — CID 80577422
2-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3-oxopiperazin-2-yl]acetic acid (PubChem CID 80577422) has the molecular formula C10H10BrClN2O5S2 and a molecular weight of 417.69 g/mol. Its IUPAC name is 2-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 80577422 |
| Molecular Formula | C10H10BrClN2O5S2 |
| Molecular Weight | 417.69 g/mol |
| Exact Mass | 415.89 |
| IUPAC Name | 2-[1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-3-oxopiperazin-2-yl]acetic acid |
| SMILES | O=C(O)CC1C(=O)NCCN1S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C10H10BrClN2O5S2/c11-9-5(12)3-8(20-9)21(18,19)14-2-1-13-10(17)6(14)4-7(15)16/h3,6H,1-2,4H2,(H,13,17)(H,15,16) |
| InChIKey | XWXIEPUTNXCGRJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.69 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |