C9H11BrClN3O3S2 — CID 80578005
1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperazine-2-carboxamide (PubChem CID 80578005) has the molecular formula C9H11BrClN3O3S2 and a molecular weight of 388.70 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperazine-2-carboxamide.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 80578005 |
| Molecular Formula | C9H11BrClN3O3S2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperazine-2-carboxamide |
| SMILES | NC(=O)C1CNCCN1S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C9H11BrClN3O3S2/c10-8-5(11)3-7(18-8)19(16,17)14-2-1-13-4-6(14)9(12)15/h3,6,13H,1-2,4H2,(H2,12,15) |
| InChIKey | QVWQJXSMUBZVSJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |