C10H13BrClNO3S2 — CID 80577698
[1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]methanol (PubChem CID 80577698) has the molecular formula C10H13BrClNO3S2 and a molecular weight of 374.71 g/mol. Its IUPAC name is [1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]methanol.
| Compound Name | [1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 80577698 |
| Molecular Formula | C10H13BrClNO3S2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 372.92 |
| IUPAC Name | [1-(5-bromo-4-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]methanol |
| SMILES | O=S(=O)(c1cc(Cl)c(Br)s1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C10H13BrClNO3S2/c11-10-8(12)5-9(17-10)18(15,16)13-3-1-7(6-14)2-4-13/h5,7,14H,1-4,6H2 |
| InChIKey | UISPFXGBRLZVCK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |