C11H18N2O5S — CID 105360846
2-(1-cyclopentylsulfonyl-3-oxopiperazin-2-yl)acetic acid (PubChem CID 105360846) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-(1-cyclopentylsulfonyl-3-oxopiperazin-2-yl)acetic acid.
| Compound Name | 2-(1-cyclopentylsulfonyl-3-oxopiperazin-2-yl)acetic acid |
|---|---|
| PubChem CID | 105360846 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(1-cyclopentylsulfonyl-3-oxopiperazin-2-yl)acetic acid |
| SMILES | O=C(O)CC1C(=O)NCCN1S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C11H18N2O5S/c14-10(15)7-9-11(16)12-5-6-13(9)19(17,18)8-3-1-2-4-8/h8-9H,1-7H2,(H,12,16)(H,14,15) |
| InChIKey | JBZWHBJOORAIQW-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |