C12H12Cl2N2O5S — CID 66756006
2-[1-(2,4-dichlorophenyl)sulfonyl-3-oxopiperazin-2-yl]acetic acid (PubChem CID 66756006) has the molecular formula C12H12Cl2N2O5S and a molecular weight of 367.21 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)sulfonyl-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-(2,4-dichlorophenyl)sulfonyl-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 66756006 |
| Molecular Formula | C12H12Cl2N2O5S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)sulfonyl-3-oxopiperazin-2-yl]acetic acid |
| SMILES | O=C(O)CC1C(=O)NCCN1S(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O5S/c13-7-1-2-10(8(14)5-7)22(20,21)16-4-3-15-12(19)9(16)6-11(17)18/h1-2,5,9H,3-4,6H2,(H,15,19)(H,17,18) |
| InChIKey | IEXLBLTYCLEDAO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |