C10H20ClN3O3S — CID 55246213
2-[4-(chloromethylsulfonyl)-1,4-diazepan-1-yl]-N,N-dimethylacetamide (PubChem CID 55246213) has the molecular formula C10H20ClN3O3S and a molecular weight of 297.81 g/mol. Its IUPAC name is 2-[4-(chloromethylsulfonyl)-1,4-diazepan-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(chloromethylsulfonyl)-1,4-diazepan-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 55246213 |
| Molecular Formula | C10H20ClN3O3S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[4-(chloromethylsulfonyl)-1,4-diazepan-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCCN(S(=O)(=O)CCl)CC1 |
| InChI | InChI=1S/C10H20ClN3O3S/c1-12(2)10(15)8-13-4-3-5-14(7-6-13)18(16,17)9-11/h3-9H2,1-2H3 |
| InChIKey | DZNGCUADPPYBOE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|