C8H18N4O3S — CID 112683880
N,N-dimethyl-2-(4-sulfamoylpiperazin-1-yl)acetamide (PubChem CID 112683880) has the molecular formula C8H18N4O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-sulfamoylpiperazin-1-yl)acetamide.
| Compound Name | N,N-dimethyl-2-(4-sulfamoylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 112683880 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N,N-dimethyl-2-(4-sulfamoylpiperazin-1-yl)acetamide |
| SMILES | CN(C)C(=O)CN1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C8H18N4O3S/c1-10(2)8(13)7-11-3-5-12(6-4-11)16(9,14)15/h3-7H2,1-2H3,(H2,9,14,15) |
| InChIKey | LDTZXTOVIJSIIN-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |