About potassium 5-amino-2-sulfophenolate
potassium 5-amino-2-sulfophenolate (PubChem CID 101303999) has the molecular formula C6H6KNO4S
and a molecular weight of 227.28 g/mol. Its IUPAC name is potassium 5-amino-2-sulfophenolate.
Molecular Properties
| Compound Name | potassium 5-amino-2-sulfophenolate |
| PubChem CID | 101303999 |
| Molecular Formula | C6H6KNO4S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | potassium 5-amino-2-sulfophenolate |
| SMILES | Nc1ccc(S(=O)(=O)O)c([O-])c1.[K+] |
| InChI | InChI=1S/C6H7NO4S.K/c7-4-1-2-6(5(8)3-4)12(9,10)11;/h1-3,8H,7H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | YQXZKRMGKMSFNF-UHFFFAOYSA-M |
| XLogP | -3.41 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium 5-amino-2-sulfophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-amino-2-sulfophenolate?
The IUPAC name of potassium 5-amino-2-sulfophenolate (CID 101303999) is potassium 5-amino-2-sulfophenolate.
What is the SMILES notation for potassium 5-amino-2-sulfophenolate?
The canonical SMILES for potassium 5-amino-2-sulfophenolate is Nc1ccc(S(=O)(=O)O)c([O-])c1.[K+].
What is the InChIKey of potassium 5-amino-2-sulfophenolate?
The InChIKey is YQXZKRMGKMSFNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO4S.K/c7-4-1-2-6(5(8)3-4)12(9,10)11;/h1-3,8H,7H2,(H,9,10,11);/q;+1/p-1.
What are the key properties of potassium 5-amino-2-sulfophenolate?
potassium 5-amino-2-sulfophenolate has a molecular weight of 227.28 g/mol, XLogP of -3.41, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-amino-2-sulfophenolate is sourced from PubChem (CID 101303999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).