C25H20Cl2O3S2 — CID 173024430
2,5-dichlorobenzenesulfonic acid;4-methyl-2,6-diphenylbenzenethiol (PubChem CID 173024430) has the molecular formula C25H20Cl2O3S2 and a molecular weight of 503.47 g/mol. Its IUPAC name is 2,5-dichlorobenzenesulfonic acid;4-methyl-2,6-diphenylbenzenethiol.
| Compound Name | 2,5-dichlorobenzenesulfonic acid;4-methyl-2,6-diphenylbenzenethiol |
|---|---|
| PubChem CID | 173024430 |
| Molecular Formula | C25H20Cl2O3S2 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 2,5-dichlorobenzenesulfonic acid;4-methyl-2,6-diphenylbenzenethiol |
| SMILES | Cc1cc(-c2ccccc2)c(S)c(-c2ccccc2)c1.O=S(=O)(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H16S.C6H4Cl2O3S/c1-14-12-17(15-8-4-2-5-9-15)19(20)18(13-14)16-10-6-3-7-11-16;7-4-1-2-5(8)6(3-4)12(9,10)11/h2-13,20H,1H3;1-3H,(H,9,10,11) |
| InChIKey | XDQBMIHXVLWJQN-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|