C14H8Cl2O9S2 — CID 154176687
5-chloro-2-(4-chloro-2-sulfobenzoyl)oxycarbonylbenzenesulfonic acid (PubChem CID 154176687) has the molecular formula C14H8Cl2O9S2 and a molecular weight of 455.25 g/mol. Its IUPAC name is 5-chloro-2-(4-chloro-2-sulfobenzoyl)oxycarbonylbenzenesulfonic acid.
| Compound Name | 5-chloro-2-(4-chloro-2-sulfobenzoyl)oxycarbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 154176687 |
| Molecular Formula | C14H8Cl2O9S2 |
| Molecular Weight | 455.25 g/mol |
| Exact Mass | 453.90 |
| IUPAC Name | 5-chloro-2-(4-chloro-2-sulfobenzoyl)oxycarbonylbenzenesulfonic acid |
| SMILES | O=C(OC(=O)c1ccc(Cl)cc1S(=O)(=O)O)c1ccc(Cl)cc1S(=O)(=O)O |
| InChI | InChI=1S/C14H8Cl2O9S2/c15-7-1-3-9(11(5-7)26(19,20)21)13(17)25-14(18)10-4-2-8(16)6-12(10)27(22,23)24/h1-6H,(H,19,20,21)(H,22,23,24) |
| InChIKey | LXCAXUFXGZXECA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|