C13H18N2O4S2 — CID 124843564
3-[[(2S)-2-methylsulfanyl-2-phenylacetyl]amino]-N-methylsulfonylpropanamide (PubChem CID 124843564) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[[(2S)-2-methylsulfanyl-2-phenylacetyl]amino]-N-methylsulfonylpropanamide.
| Compound Name | 3-[[(2S)-2-methylsulfanyl-2-phenylacetyl]amino]-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 124843564 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-[[(2S)-2-methylsulfanyl-2-phenylacetyl]amino]-N-methylsulfonylpropanamide |
| SMILES | CS[C@H](C(=O)NCCC(=O)NS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-20-12(10-6-4-3-5-7-10)13(17)14-9-8-11(16)15-21(2,18)19/h3-7,12H,8-9H2,1-2H3,(H,14,17)(H,15,16)/t12-/m0/s1 |
| InChIKey | DXRKXDMYSYVYHM-LBPRGKRZSA-N |
| XLogP | 0.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |