C14H31N3O10P2ReS2-2 — CID 11983266
[1-hydroxy-4-[4-[[2-oxo-2-(2-sulfanylethylamino)ethyl]-(2-sulfanylethyl)amino]butanoylamino]-1-phosphonobutyl]phosphonic acid;oxygen(2-);rhenium (PubChem CID 11983266) has the molecular formula C14H31N3O10P2ReS2-2 and a molecular weight of 713.70 g/mol. Its IUPAC name is [1-hydroxy-4-[4-[[2-oxo-2-(2-sulfanylethylamino)ethyl]-(2-sulfanylethyl)amino]butanoylamino]-1-phosphonobutyl]phosphonic acid;oxygen(2-);rhenium.
| Compound Name | [1-hydroxy-4-[4-[[2-oxo-2-(2-sulfanylethylamino)ethyl]-(2-sulfanylethyl)amino]butanoylamino]-1-phosphonobutyl]phosphonic acid;oxygen(2-);rhenium |
|---|---|
| PubChem CID | 11983266 |
| Molecular Formula | C14H31N3O10P2ReS2-2 |
| Molecular Weight | 713.70 g/mol |
| Exact Mass | 714.05 |
| IUPAC Name | [1-hydroxy-4-[4-[[2-oxo-2-(2-sulfanylethylamino)ethyl]-(2-sulfanylethyl)amino]butanoylamino]-1-phosphonobutyl]phosphonic acid;oxygen(2-);rhenium |
| SMILES | O=C(CCCN(CCS)CC(=O)NCCS)NCCCC(O)(P(=O)(O)O)P(=O)(O)O.[O-2].[Re] |
| InChI | InChI=1S/C14H31N3O9P2S2.O.Re/c18-12(3-1-7-17(8-10-30)11-13(19)16-6-9-29)15-5-2-4-14(20,27(21,22)23)28(24,25)26;;/h20,29-30H,1-11H2,(H,15,18)(H,16,19)(H2,21,22,23)(H2,24,25,26);;/q;-2; |
| InChIKey | WSZUUIHVZDXFNN-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 225.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.70 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|