C14H27NO11P2 — CID 161066265
(2S)-7-[(4-hydroxy-4,4-diphosphonobutyl)amino]-4,7-dioxo-2-propan-2-ylheptanoic acid (PubChem CID 161066265) has the molecular formula C14H27NO11P2 and a molecular weight of 447.31 g/mol. Its IUPAC name is (2S)-7-[(4-hydroxy-4,4-diphosphonobutyl)amino]-4,7-dioxo-2-propan-2-ylheptanoic acid.
| Compound Name | (2S)-7-[(4-hydroxy-4,4-diphosphonobutyl)amino]-4,7-dioxo-2-propan-2-ylheptanoic acid |
|---|---|
| PubChem CID | 161066265 |
| Molecular Formula | C14H27NO11P2 |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (2S)-7-[(4-hydroxy-4,4-diphosphonobutyl)amino]-4,7-dioxo-2-propan-2-ylheptanoic acid |
| SMILES | CC(C)C(CC(=O)CCC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C14H27NO11P2/c1-9(2)11(13(18)19)8-10(16)4-5-12(17)15-7-3-6-14(20,27(21,22)23)28(24,25)26/h9,11,20H,3-8H2,1-2H3,(H,15,17)(H,18,19)(H2,21,22,23)(H2,24,25,26) |
| InChIKey | UEBGLRNIHYOFSC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 218.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|