C9H20N2O7P2S — CID 123556396
[2-[(4-dimethylphosphoryl-4-hydroxy-4-phosphonobutyl)amino]-2-oxoethyl]carbamothioic S-acid (PubChem CID 123556396) has the molecular formula C9H20N2O7P2S and a molecular weight of 362.28 g/mol. Its IUPAC name is [2-[(4-dimethylphosphoryl-4-hydroxy-4-phosphonobutyl)amino]-2-oxoethyl]carbamothioic S-acid.
| Compound Name | [2-[(4-dimethylphosphoryl-4-hydroxy-4-phosphonobutyl)amino]-2-oxoethyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 123556396 |
| Molecular Formula | C9H20N2O7P2S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | [2-[(4-dimethylphosphoryl-4-hydroxy-4-phosphonobutyl)amino]-2-oxoethyl]carbamothioic S-acid |
| SMILES | CP(C)(=O)C(O)(CCCNC(=O)CNC(=O)S)P(=O)(O)O |
| InChI | InChI=1S/C9H20N2O7P2S/c1-19(2,15)9(14,20(16,17)18)4-3-5-10-7(12)6-11-8(13)21/h14H,3-6H2,1-2H3,(H,10,12)(H2,11,13,21)(H2,16,17,18) |
| InChIKey | OYHKFWWDJTUQRY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|