C12H19NO8P2 — CID 174302024
[1-hydroxy-4-[(4-methylbenzoyl)amino]-1-phosphonobutyl]phosphonic acid (PubChem CID 174302024) has the molecular formula C12H19NO8P2 and a molecular weight of 367.23 g/mol. Its IUPAC name is [1-hydroxy-4-[(4-methylbenzoyl)amino]-1-phosphonobutyl]phosphonic acid.
| Compound Name | [1-hydroxy-4-[(4-methylbenzoyl)amino]-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 174302024 |
| Molecular Formula | C12H19NO8P2 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | [1-hydroxy-4-[(4-methylbenzoyl)amino]-1-phosphonobutyl]phosphonic acid |
| SMILES | Cc1ccc(C(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C12H19NO8P2/c1-9-3-5-10(6-4-9)11(14)13-8-2-7-12(15,22(16,17)18)23(19,20)21/h3-6,15H,2,7-8H2,1H3,(H,13,14)(H2,16,17,18)(H2,19,20,21) |
| InChIKey | HEPCFGMVTJHEKD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|