C6H17N3O8P2 — CID 24768570
[4-[(2-hydrazinylacetyl)amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid (PubChem CID 24768570) has the molecular formula C6H17N3O8P2 and a molecular weight of 321.16 g/mol. Its IUPAC name is [4-[(2-hydrazinylacetyl)amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[(2-hydrazinylacetyl)amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 24768570 |
| Molecular Formula | C6H17N3O8P2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | [4-[(2-hydrazinylacetyl)amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
| SMILES | NNCC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H17N3O8P2/c7-9-4-5(10)8-3-1-2-6(11,18(12,13)14)19(15,16)17/h9,11H,1-4,7H2,(H,8,10)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | ALYCWFKNRZAIRZ-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 202.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|