C12H26N4O17P4S — CID 87469930
[3,4-dicarbamoyl-6-[(4-hydroxy-4,4-diphosphonobutyl)amino]-1,6-dioxo-1-(phosphonoamino)-2-sulfanylhexan-3-yl]phosphonic acid (PubChem CID 87469930) has the molecular formula C12H26N4O17P4S and a molecular weight of 654.31 g/mol. Its IUPAC name is [3,4-dicarbamoyl-6-[(4-hydroxy-4,4-diphosphonobutyl)amino]-1,6-dioxo-1-(phosphonoamino)-2-sulfanylhexan-3-yl]phosphonic acid.
| Compound Name | [3,4-dicarbamoyl-6-[(4-hydroxy-4,4-diphosphonobutyl)amino]-1,6-dioxo-1-(phosphonoamino)-2-sulfanylhexan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 87469930 |
| Molecular Formula | C12H26N4O17P4S |
| Molecular Weight | 654.31 g/mol |
| Exact Mass | 654.00 |
| IUPAC Name | [3,4-dicarbamoyl-6-[(4-hydroxy-4,4-diphosphonobutyl)amino]-1,6-dioxo-1-(phosphonoamino)-2-sulfanylhexan-3-yl]phosphonic acid |
| SMILES | NC(=O)C(CC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)C(C(N)=O)(C(S)C(=O)NP(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H26N4O17P4S/c13-8(18)5(4-6(17)15-3-1-2-11(21,34(22,23)24)35(25,26)27)12(10(14)20,36(28,29)30)7(38)9(19)16-37(31,32)33/h5,7,21,38H,1-4H2,(H2,13,18)(H2,14,20)(H,15,17)(H2,22,23,24)(H2,25,26,27)(H2,28,29,30)(H3,16,19,31,32,33) |
| InChIKey | PMYWNWUGYVVXOE-UHFFFAOYSA-N |
| XLogP | -4.72 |
| TPSA | 394.73 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.31 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|