C8H21NO7P2 — CID 162426140
[1-hydroxy-4-(2-methylpropylamino)-1-phosphonobutyl]phosphonic acid (PubChem CID 162426140) has the molecular formula C8H21NO7P2 and a molecular weight of 305.20 g/mol. Its IUPAC name is [1-hydroxy-4-(2-methylpropylamino)-1-phosphonobutyl]phosphonic acid.
| Compound Name | [1-hydroxy-4-(2-methylpropylamino)-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 162426140 |
| Molecular Formula | C8H21NO7P2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | [1-hydroxy-4-(2-methylpropylamino)-1-phosphonobutyl]phosphonic acid |
| SMILES | CC(C)CNCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C8H21NO7P2/c1-7(2)6-9-5-3-4-8(10,17(11,12)13)18(14,15)16/h7,9-10H,3-6H2,1-2H3,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | LXSILKPNDPWEMR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|