C9H18NO8P2+ — CID 118494670
hydroxy-[1-hydroxy-4-(4-oxopentanoylamino)-1-phosphonobutyl]-oxophosphanium (PubChem CID 118494670) has the molecular formula C9H18NO8P2+ and a molecular weight of 330.19 g/mol. Its IUPAC name is hydroxy-[1-hydroxy-4-(4-oxopentanoylamino)-1-phosphonobutyl]-oxophosphanium.
| Compound Name | hydroxy-[1-hydroxy-4-(4-oxopentanoylamino)-1-phosphonobutyl]-oxophosphanium |
|---|---|
| PubChem CID | 118494670 |
| Molecular Formula | C9H18NO8P2+ |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | hydroxy-[1-hydroxy-4-(4-oxopentanoylamino)-1-phosphonobutyl]-oxophosphanium |
| SMILES | CC(=O)CCC(=O)NCCCC(O)([P+](=O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H17NO8P2/c1-7(11)3-4-8(12)10-6-2-5-9(13,19(14)15)20(16,17)18/h13H,2-6H2,1H3,(H3-,10,12,14,15,16,17,18)/p+1 |
| InChIKey | DCWUKUZZMOEWSD-UHFFFAOYSA-O |
| XLogP | -0.19 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|