C17H31N3O2 — CID 3216036
4-N-butyl-1-N-cyclohexylpiperidine-1,4-dicarboxamide (PubChem CID 3216036) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 4-N-butyl-1-N-cyclohexylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-butyl-1-N-cyclohexylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 3216036 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 4-N-butyl-1-N-cyclohexylpiperidine-1,4-dicarboxamide |
| SMILES | CCCCNC(=O)C1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H31N3O2/c1-2-3-11-18-16(21)14-9-12-20(13-10-14)17(22)19-15-7-5-4-6-8-15/h14-15H,2-13H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | KQAFXXWVMJICOM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|