C13H23N3O3 — CID 47151765
1-N-cyclopropyl-4-N-(2-methoxyethyl)piperidine-1,4-dicarboxamide (PubChem CID 47151765) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-N-cyclopropyl-4-N-(2-methoxyethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-cyclopropyl-4-N-(2-methoxyethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 47151765 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-N-cyclopropyl-4-N-(2-methoxyethyl)piperidine-1,4-dicarboxamide |
| SMILES | COCCNC(=O)C1CCN(C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C13H23N3O3/c1-19-9-6-14-12(17)10-4-7-16(8-5-10)13(18)15-11-2-3-11/h10-11H,2-9H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | OESUSRGVWGSXKX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|