C23H37N3O3 — CID 55852879
1-[2-(4-tert-butylanilino)-2-oxoethyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide (PubChem CID 55852879) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[2-(4-tert-butylanilino)-2-oxoethyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-tert-butylanilino)-2-oxoethyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55852879 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | 1-[2-(4-tert-butylanilino)-2-oxoethyl]-N-(3-ethoxypropyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(CC(=O)Nc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H37N3O3/c1-5-29-16-6-13-24-22(28)18-11-14-26(15-12-18)17-21(27)25-20-9-7-19(8-10-20)23(2,3)4/h7-10,18H,5-6,11-17H2,1-4H3,(H,24,28)(H,25,27) |
| InChIKey | BNEAKEJYAOCKCK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|