C18H27ClN2O3 — CID 119906651
1-[2-(4-tert-butylanilino)-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 119906651) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-[2-(4-tert-butylanilino)-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-(4-tert-butylanilino)-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119906651 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[2-(4-tert-butylanilino)-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | CC(C)(C)c1ccc(NC(=O)CN2CCC(C(=O)O)CC2)cc1.Cl |
| InChI | InChI=1S/C18H26N2O3.ClH/c1-18(2,3)14-4-6-15(7-5-14)19-16(21)12-20-10-8-13(9-11-20)17(22)23;/h4-7,13H,8-12H2,1-3H3,(H,19,21)(H,22,23);1H |
| InChIKey | JFSZZGRFLPDAAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |