About 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide
1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide (PubChem CID 86986547) has the molecular formula C22H35N3O3
and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide |
| PubChem CID | 86986547 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(C(=O)Nc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H35N3O3/c1-5-28-16-6-13-23-20(26)17-11-14-25(15-12-17)21(27)24-19-9-7-18(8-10-19)22(2,3)4/h7-10,17H,5-6,11-16H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | POHJCAOTHCHSAF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide?
The IUPAC name of 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide (CID 86986547) is 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide.
What is the SMILES notation for 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide?
The canonical SMILES for 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide is CCOCCCNC(=O)C1CCN(C(=O)Nc2ccc(C(C)(C)C)cc2)CC1.
What is the InChIKey of 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide?
The InChIKey is POHJCAOTHCHSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35N3O3/c1-5-28-16-6-13-23-20(26)17-11-14-25(15-12-17)21(27)24-19-9-7-18(8-10-19)22(2,3)4/h7-10,17H,5-6,11-16H2,1-4H3,(H,23,26)(H,24,27).
What are the key properties of 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide?
1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide has a molecular weight of 389.54 g/mol, XLogP of 3.77, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(4-tert-butylphenyl)-4-N-(3-ethoxypropyl)piperidine-1,4-dicarboxamide is sourced from PubChem (CID 86986547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).