C14H23F3N2O3 — CID 86985142
N-(3-ethoxypropyl)-1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxamide (PubChem CID 86985142) has the molecular formula C14H23F3N2O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86985142 |
| Molecular Formula | C14H23F3N2O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-(3-ethoxypropyl)-1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxamide |
| SMILES | CCOCCCNC(=O)C1CCN(C(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H23F3N2O3/c1-2-22-9-3-6-18-13(21)11-4-7-19(8-5-11)12(20)10-14(15,16)17/h11H,2-10H2,1H3,(H,18,21) |
| InChIKey | YFRXCMNUOZTYFA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|