C14H15Cl2N3O — CID 48940747
2-(4-cyanopiperidin-1-yl)-N-(2,5-dichlorophenyl)acetamide (PubChem CID 48940747) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 2-(4-cyanopiperidin-1-yl)-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(4-cyanopiperidin-1-yl)-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 48940747 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-(4-cyanopiperidin-1-yl)-N-(2,5-dichlorophenyl)acetamide |
| SMILES | N#CC1CCN(CC(=O)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H15Cl2N3O/c15-11-1-2-12(16)13(7-11)18-14(20)9-19-5-3-10(8-17)4-6-19/h1-2,7,10H,3-6,9H2,(H,18,20) |
| InChIKey | CGPOGMCQGJBRBN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |