C17H22Cl2N4O2 — CID 46663083
2-[4-[2-(2,5-dichloroanilino)-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 46663083) has the molecular formula C17H22Cl2N4O2 and a molecular weight of 385.30 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dichloroanilino)-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[2-(2,5-dichloroanilino)-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 46663083 |
| Molecular Formula | C17H22Cl2N4O2 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[4-[2-(2,5-dichloroanilino)-2-oxoethyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(CC(=O)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N4O2/c1-2-5-20-16(24)11-22-6-8-23(9-7-22)12-17(25)21-15-10-13(18)3-4-14(15)19/h2-4,10H,1,5-9,11-12H2,(H,20,24)(H,21,25) |
| InChIKey | YAZSMLAXXVCSHV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|