C12H12Cl2N2O2 — CID 108941338
N'-(2,5-dichlorophenyl)-N-prop-2-enylpropanediamide (PubChem CID 108941338) has the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.15 g/mol. Its IUPAC name is N'-(2,5-dichlorophenyl)-N-prop-2-enylpropanediamide.
| Compound Name | N'-(2,5-dichlorophenyl)-N-prop-2-enylpropanediamide |
|---|---|
| PubChem CID | 108941338 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | N'-(2,5-dichlorophenyl)-N-prop-2-enylpropanediamide |
| SMILES | C=CCNC(=O)CC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O2/c1-2-5-15-11(17)7-12(18)16-10-6-8(13)3-4-9(10)14/h2-4,6H,1,5,7H2,(H,15,17)(H,16,18) |
| InChIKey | BWDUCTUASFYXQL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|