C19H24Cl2N4O4 — CID 30599791
methyl 3,5-dichloro-2-[[2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]acetyl]amino]benzoate (PubChem CID 30599791) has the molecular formula C19H24Cl2N4O4 and a molecular weight of 443.33 g/mol. Its IUPAC name is methyl 3,5-dichloro-2-[[2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 3,5-dichloro-2-[[2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30599791 |
| Molecular Formula | C19H24Cl2N4O4 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | methyl 3,5-dichloro-2-[[2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]acetyl]amino]benzoate |
| SMILES | C=CCNC(=O)CN1CCN(CC(=O)Nc2c(Cl)cc(Cl)cc2C(=O)OC)CC1 |
| InChI | InChI=1S/C19H24Cl2N4O4/c1-3-4-22-16(26)11-24-5-7-25(8-6-24)12-17(27)23-18-14(19(28)29-2)9-13(20)10-15(18)21/h3,9-10H,1,4-8,11-12H2,2H3,(H,22,26)(H,23,27) |
| InChIKey | WFAOZCHYSRPNDM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|