C18H20F3N3O5S2 — CID 55820146
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 55820146) has the molecular formula C18H20F3N3O5S2 and a molecular weight of 479.50 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55820146 |
| Molecular Formula | C18H20F3N3O5S2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H20F3N3O5S2/c19-18(20,21)13-2-1-3-14(10-13)31(28,29)23-7-4-12(5-8-23)16(26)22-6-9-24-15(25)11-30-17(24)27/h1-3,10,12H,4-9,11H2,(H,22,26) |
| InChIKey | ARSNLXZQUPHMOU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|