C22H21F4NO4S — CID 58235401
(E)-4-(4-fluorophenyl)-1-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxybut-3-en-2-one (PubChem CID 58235401) has the molecular formula C22H21F4NO4S and a molecular weight of 471.47 g/mol. Its IUPAC name is (E)-4-(4-fluorophenyl)-1-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxybut-3-en-2-one.
| Compound Name | (E)-4-(4-fluorophenyl)-1-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxybut-3-en-2-one |
|---|---|
| PubChem CID | 58235401 |
| Molecular Formula | C22H21F4NO4S |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (E)-4-(4-fluorophenyl)-1-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxybut-3-en-2-one |
| SMILES | O=C(/C=C/c1ccc(F)cc1)COC1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H21F4NO4S/c23-18-7-4-16(5-8-18)6-9-19(28)15-31-20-10-12-27(13-11-20)32(29,30)21-3-1-2-17(14-21)22(24,25)26/h1-9,14,20H,10-13,15H2/b9-6+ |
| InChIKey | KIPAEHUSWHCXGZ-RMKNXTFCSA-N |
| XLogP | 4.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|