C17H18F3N3O3S — CID 90559746
3-methyl-6-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxypyridazine (PubChem CID 90559746) has the molecular formula C17H18F3N3O3S and a molecular weight of 401.41 g/mol. Its IUPAC name is 3-methyl-6-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxypyridazine.
| Compound Name | 3-methyl-6-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxypyridazine |
|---|---|
| PubChem CID | 90559746 |
| Molecular Formula | C17H18F3N3O3S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 3-methyl-6-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]oxypyridazine |
| SMILES | Cc1ccc(OC2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)nn1 |
| InChI | InChI=1S/C17H18F3N3O3S/c1-12-5-6-16(22-21-12)26-14-7-9-23(10-8-14)27(24,25)15-4-2-3-13(11-15)17(18,19)20/h2-6,11,14H,7-10H2,1H3 |
| InChIKey | JDHUWAQODJIEEW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |