C38H39Br — CID 58370979
2-(4-bromophenyl)-5,8,11-tritert-butylperylene (PubChem CID 58370979) has the molecular formula C38H39Br and a molecular weight of 575.63 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5,8,11-tritert-butylperylene.
| Compound Name | 2-(4-bromophenyl)-5,8,11-tritert-butylperylene |
|---|---|
| PubChem CID | 58370979 |
| Molecular Formula | C38H39Br |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 2-(4-bromophenyl)-5,8,11-tritert-butylperylene |
| SMILES | CC(C)(C)c1cc2cc(-c3ccc(Br)cc3)cc3c4cc(C(C)(C)C)cc5cc(C(C)(C)C)cc(c(c1)c23)c54 |
| InChI | InChI=1S/C38H39Br/c1-36(2,3)26-15-24-14-23(22-10-12-29(39)13-11-22)18-30-31-19-27(37(4,5)6)16-25-17-28(38(7,8)9)21-33(35(25)31)32(20-26)34(24)30/h10-21H,1-9H3 |
| InChIKey | ADNVPLAHMCFIGL-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|