C76H68 — CID 58435343
2,8-bis(3,7-ditert-butylnaphthalen-1-yl)-5,11-dinaphthalen-1-ylperylene (PubChem CID 58435343) has the molecular formula C76H68 and a molecular weight of 981.38 g/mol. Its IUPAC name is 2,8-bis(3,7-ditert-butylnaphthalen-1-yl)-5,11-dinaphthalen-1-ylperylene.
| Compound Name | 2,8-bis(3,7-ditert-butylnaphthalen-1-yl)-5,11-dinaphthalen-1-ylperylene |
|---|---|
| PubChem CID | 58435343 |
| Molecular Formula | C76H68 |
| Molecular Weight | 981.38 g/mol |
| Exact Mass | 980.53 |
| IUPAC Name | 2,8-bis(3,7-ditert-butylnaphthalen-1-yl)-5,11-dinaphthalen-1-ylperylene |
| SMILES | CC(C)(C)c1cc(-c2cc3cc(-c4cccc5ccccc45)cc4c5cc(-c6cc(C(C)(C)C)cc7ccc(C(C)(C)C)cc67)cc6cc(-c7cccc8ccccc78)cc(c(c2)c34)c65)c2cc(C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C76H68/c1-73(2,3)55-29-27-47-35-57(75(7,8)9)43-65(63(47)41-55)51-33-53-31-49(61-25-17-21-45-19-13-15-23-59(45)61)38-68-70-40-52(66-44-58(76(10,11)12)36-48-28-30-56(42-64(48)66)74(4,5)6)34-54-32-50(37-67(72(54)70)69(39-51)71(53)68)62-26-18-22-46-20-14-16-24-60(46)62/h13-44H,1-12H3 |
| InChIKey | PSYJQQMTMRZKTL-UHFFFAOYSA-N |
| XLogP | 22.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.38 |
| LogP ≤ 5 | 22.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|