C38H36N2 — CID 155643269
4-tert-butyl-2-[4-[7-(4-tert-butyl-2-pyridinyl)naphthalen-1-yl]naphthalen-2-yl]pyridine (PubChem CID 155643269) has the molecular formula C38H36N2 and a molecular weight of 520.72 g/mol. Its IUPAC name is 4-tert-butyl-2-[4-[7-(4-tert-butyl-2-pyridinyl)naphthalen-1-yl]naphthalen-2-yl]pyridine.
| Compound Name | 4-tert-butyl-2-[4-[7-(4-tert-butyl-2-pyridinyl)naphthalen-1-yl]naphthalen-2-yl]pyridine |
|---|---|
| PubChem CID | 155643269 |
| Molecular Formula | C38H36N2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 4-tert-butyl-2-[4-[7-(4-tert-butyl-2-pyridinyl)naphthalen-1-yl]naphthalen-2-yl]pyridine |
| SMILES | CC(C)(C)c1ccnc(-c2cc(-c3cccc4ccc(-c5cc(C(C)(C)C)ccn5)cc34)c3ccccc3c2)c1 |
| InChI | InChI=1S/C38H36N2/c1-37(2,3)29-16-18-39-35(23-29)27-15-14-25-11-9-13-32(33(25)21-27)34-22-28(20-26-10-7-8-12-31(26)34)36-24-30(17-19-40-36)38(4,5)6/h7-24H,1-6H3 |
| InChIKey | AFEAJYMKLDOCTL-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |