C42H38N2 — CID 155643331
6-tert-butyl-1-[3-[7-(6-tert-butylisoquinolin-1-yl)naphthalen-1-yl]phenyl]isoquinoline (PubChem CID 155643331) has the molecular formula C42H38N2 and a molecular weight of 570.78 g/mol. Its IUPAC name is 6-tert-butyl-1-[3-[7-(6-tert-butylisoquinolin-1-yl)naphthalen-1-yl]phenyl]isoquinoline.
| Compound Name | 6-tert-butyl-1-[3-[7-(6-tert-butylisoquinolin-1-yl)naphthalen-1-yl]phenyl]isoquinoline |
|---|---|
| PubChem CID | 155643331 |
| Molecular Formula | C42H38N2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 6-tert-butyl-1-[3-[7-(6-tert-butylisoquinolin-1-yl)naphthalen-1-yl]phenyl]isoquinoline |
| SMILES | CC(C)(C)c1ccc2c(-c3cccc(-c4cccc5ccc(-c6nccc7cc(C(C)(C)C)ccc67)cc45)c3)nccc2c1 |
| InChI | InChI=1S/C42H38N2/c1-41(2,3)33-15-17-36-29(24-33)19-21-43-39(36)31-11-7-10-28(23-31)35-12-8-9-27-13-14-32(26-38(27)35)40-37-18-16-34(42(4,5)6)25-30(37)20-22-44-40/h7-26H,1-6H3 |
| InChIKey | ZFGAHFXAVRNFAZ-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |