C82H71N3 — CID 134191404
1-[4-[2-[3,5-bis[2-[4-(4-tert-butyl-2-pyridinyl)phenyl]phenyl]phenyl]phenyl]-3-methylphenyl]-8-tert-butylnaphtho[2,1-f]isoquinoline (PubChem CID 134191404) has the molecular formula C82H71N3 and a molecular weight of 1098.49 g/mol. Its IUPAC name is 1-[4-[2-[3,5-bis[2-[4-(4-tert-butyl-2-pyridinyl)phenyl]phenyl]phenyl]phenyl]-3-methylphenyl]-8-tert-butylnaphtho[2,1-f]isoquinoline.
| Compound Name | 1-[4-[2-[3,5-bis[2-[4-(4-tert-butyl-2-pyridinyl)phenyl]phenyl]phenyl]phenyl]-3-methylphenyl]-8-tert-butylnaphtho[2,1-f]isoquinoline |
|---|---|
| PubChem CID | 134191404 |
| Molecular Formula | C82H71N3 |
| Molecular Weight | 1098.49 g/mol |
| Exact Mass | 1097.56 |
| IUPAC Name | 1-[4-[2-[3,5-bis[2-[4-(4-tert-butyl-2-pyridinyl)phenyl]phenyl]phenyl]phenyl]-3-methylphenyl]-8-tert-butylnaphtho[2,1-f]isoquinoline |
| SMILES | Cc1cc(-c2nccc3c2ccc2c4ccc(C(C)(C)C)cc4ccc32)ccc1-c1ccccc1-c1cc(-c2ccccc2-c2ccc(-c3cc(C(C)(C)C)ccn3)cc2)cc(-c2ccccc2-c2ccc(-c3cc(C(C)(C)C)ccn3)cc2)c1 |
| InChI | InChI=1S/C82H71N3/c1-52-45-58(79-76-38-37-73-71-36-33-62(80(2,3)4)49-57(71)31-35-74(73)75(76)41-44-85-79)32-34-65(52)72-22-16-15-21-70(72)61-47-59(68-19-13-11-17-66(68)53-23-27-55(28-24-53)77-50-63(39-42-83-77)81(5,6)7)46-60(48-61)69-20-14-12-18-67(69)54-25-29-56(30-26-54)78-51-64(40-43-84-78)82(8,9)10/h11-51H,1-10H3 |
| InChIKey | MOSGWYDKKHBQOB-UHFFFAOYSA-N |
| XLogP | 22.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.49 |
| LogP ≤ 5 | 22.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|