C38H36N2O — CID 153429141
1-[3-tert-butyl-5-[4-(4-tert-butyl-2-pyridinyl)naphthalen-2-yl]oxyphenyl]isoquinoline (PubChem CID 153429141) has the molecular formula C38H36N2O and a molecular weight of 536.72 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-[4-(4-tert-butyl-2-pyridinyl)naphthalen-2-yl]oxyphenyl]isoquinoline.
| Compound Name | 1-[3-tert-butyl-5-[4-(4-tert-butyl-2-pyridinyl)naphthalen-2-yl]oxyphenyl]isoquinoline |
|---|---|
| PubChem CID | 153429141 |
| Molecular Formula | C38H36N2O |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 1-[3-tert-butyl-5-[4-(4-tert-butyl-2-pyridinyl)naphthalen-2-yl]oxyphenyl]isoquinoline |
| SMILES | CC(C)(C)c1cc(Oc2cc(-c3cc(C(C)(C)C)ccn3)c3ccccc3c2)cc(-c2nccc3ccccc23)c1 |
| InChI | InChI=1S/C38H36N2O/c1-37(2,3)28-16-18-39-35(23-28)34-24-31(20-26-12-8-9-13-32(26)34)41-30-21-27(19-29(22-30)38(4,5)6)36-33-14-10-7-11-25(33)15-17-40-36/h7-24H,1-6H3 |
| InChIKey | IRQVPPIGMBFDAN-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |